
CAS 1111116-08-5
:5-(3-Chlorophenyl)-2(1H)-pyridinone
Description:
5-(3-Chlorophenyl)-2(1H)-pyridinone is an organic compound characterized by its pyridinone structure, which features a pyridine ring fused with a carbonyl group. The presence of a 3-chlorophenyl group indicates that there is a chlorine atom attached to the phenyl ring at the meta position relative to the carbon that connects to the pyridinone. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the carbonyl and aromatic systems. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to its functional groups. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed.
Formula:C11H8ClNO
InChI:InChI=1S/C11H8ClNO/c12-10-3-1-2-8(6-10)9-4-5-11(14)13-7-9/h1-7H,(H,13,14)
InChI key:InChIKey=VYHOALLCRGAOOJ-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1)C=2C=CC(=O)NC2
Synonyms:- 2(1H)-Pyridinone, 5-(3-chlorophenyl)-
- 5-(3-Chlorophenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.