
CAS 1111120-40-1
:3′-Chloro-5′-fluoro-4-hydroxy[1,1′-biphenyl]-3-carboxaldehyde
Description:
3′-Chloro-5′-fluoro-4-hydroxy[1,1′-biphenyl]-3-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxaldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as oxidation and condensation. The compound features a hydroxyl group (-OH) at the 4-position, contributing to its potential as a phenolic compound, which may exhibit antioxidant properties. The chlorine and fluorine substituents at the 3′ and 5′ positions, respectively, introduce unique electronic and steric effects, potentially influencing the compound's reactivity and solubility. This compound may be of interest in medicinal chemistry and materials science due to its structural features, which could lead to specific biological activities or applications in organic synthesis. Its properties, such as melting point, boiling point, and solubility, would depend on the interactions of these functional groups and the overall molecular structure.
Formula:C13H8ClFO2
InChI:InChI=1S/C13H8ClFO2/c14-11-4-9(5-12(15)6-11)8-1-2-13(17)10(3-8)7-16/h1-7,17H
InChI key:InChIKey=QSGJIYNZJIIZPT-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C=CC1O)C2=CC(Cl)=CC(F)=C2
Synonyms:- [1,1′-Biphenyl]-3-carboxaldehyde, 3′-chloro-5′-fluoro-4-hydroxy-
- 3′-Chloro-5′-fluoro-4-hydroxy[1,1′-biphenyl]-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.