CymitQuimica logo

CAS 111115-19-6

:

Butanedioic acid, 1,1′-[(1R,2R)-2-[(2,2-dichloroacetyl)amino]-1-(4-nitrophenyl)-1,3-propanediyl] ester

Description:
Butanedioic acid, 1,1′-[(1R,2R)-2-[(2,2-dichloroacetyl)amino]-1-(4-nitrophenyl)-1,3-propanediyl] ester, also known by its CAS number 111115-19-6, is a complex organic compound characterized by its ester functional group derived from butanedioic acid. This compound features a chiral center, indicated by the (1R,2R) configuration, which contributes to its stereochemistry and potential biological activity. The presence of a 4-nitrophenyl group suggests that it may exhibit specific electronic properties, potentially influencing its reactivity and interactions with biological systems. Additionally, the dichloroacetyl moiety indicates that the compound may possess significant electrophilic characteristics, which could be relevant in medicinal chemistry or synthetic applications. Overall, this compound's unique structure, including multiple functional groups and stereocenters, suggests it may have specialized applications in pharmaceuticals or as a chemical intermediate in organic synthesis. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C19H20Cl2N2O11
InChI:InChI=1S/C19H20Cl2N2O11/c20-18(21)19(30)22-12(9-33-15(28)7-5-13(24)25)17(34-16(29)8-6-14(26)27)10-1-3-11(4-2-10)23(31)32/h1-4,12,17-18H,5-9H2,(H,22,30)(H,24,25)(H,26,27)/t12-,17-/m1/s1
InChI key:InChIKey=JTLJNYWTEQGVSP-SJKOYZFVSA-N
SMILES:[C@@H]([C@@H](COC(CCC(O)=O)=O)NC(C(Cl)Cl)=O)(OC(CCC(O)=O)=O)C1=CC=C(N(=O)=O)C=C1
Synonyms:
  • Butanedioic acid, 1,1′-[(1R,2R)-2-[(2,2-dichloroacetyl)amino]-1-(4-nitrophenyl)-1,3-propanediyl] ester
  • Chloramphenicol, diester with succinic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.