CymitQuimica logo

CAS 111119-37-0

:

2,6-Dichloro-L-phenylalanine

Description:
2,6-Dichloro-L-phenylalanine is an amino acid derivative characterized by the presence of two chlorine atoms at the 2 and 6 positions of the phenyl ring, which is attached to the alpha carbon of the L-phenylalanine structure. This compound is notable for its potential applications in biochemical research and pharmaceutical development, particularly in the study of protein synthesis and enzyme inhibition. It exhibits properties typical of amino acids, including the ability to participate in peptide bond formation and interactions with biological receptors. The presence of chlorine substituents can influence its solubility, reactivity, and biological activity compared to its non-chlorinated counterparts. Additionally, 2,6-Dichloro-L-phenylalanine may exhibit unique pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves chlorination reactions and careful purification to ensure the desired stereochemistry and functional characteristics are maintained. As with many chemical substances, safety precautions should be observed when handling this compound due to its potential biological effects.
Formula:C9H9Cl2NO2
InChI:InChI=1S/C9H9Cl2NO2/c10-6-2-1-3-7(11)5(6)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14)/t8-/m0/s1
InChI key:InChIKey=LWFYNRYRKMEIIJ-QMMMGPOBSA-N
SMILES:C([C@@H](C(O)=O)N)C1=C(Cl)C=CC=C1Cl
Synonyms:
  • (S)-2-Amino-3-(2,6-dichlorophenyl)propanoic acid
  • 2,6-Dichloro-L-phenylalanine
  • (S)-2-Amino-3-(2,6-dichlorophenyl)propanoicacid
  • (2S)-2-Amino-3-(2,6-dichlorophenyl)propanoic acid
  • L-Phenylalanine, 2,6-dichloro-
Found 1 products.