CAS 111128-27-9
:bupleurotoxin
Description:
Bupleurotoxin is a chemical compound classified as a neurotoxin, primarily derived from the plant species Bupleurum. It is known for its potent effects on the nervous system, particularly its ability to interfere with neurotransmitter release and neuronal signaling. The compound exhibits a complex structure that contributes to its biological activity, and it is often studied for its potential pharmacological applications, including analgesic and anti-inflammatory properties. Bupleurotoxin's mechanism of action involves modulation of ion channels and receptors, which can lead to significant physiological effects. Due to its toxicity, it is essential to handle bupleurotoxin with caution in laboratory settings, and its use is typically restricted to research purposes. The compound's safety profile and potential therapeutic benefits are subjects of ongoing research, as scientists seek to understand its full range of effects and possible applications in medicine. Overall, bupleurotoxin represents a fascinating area of study within the field of natural products and neuropharmacology.
Formula:C17H22O2
InChI:InChI=1/C17H22O2/c1-2-14-17(19)15-12-10-8-6-4-3-5-7-9-11-13-16-18/h4,6,8,10-11,13,17-19H,2,12,14-16H2,1H3/b6-4+,10-8+,13-11-
Synonyms:- 14-Hydroxy-bupleurynol
- 2,8,10-Heptadecatriene-4,6-diyne-1,14-diol, (Z,E,E)-
- (2Z,8E,10E)-heptadeca-2,8,10-triene-4,6-diyne-1,14-diol
- Bupleurotoxin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
