CAS 111128-30-4
:14-acetoxybupleurotoxin
Description:
14-Acetoxybupleurotoxin is a chemical compound belonging to the class of alkaloids, specifically derived from the plant species of the genus Bupleurum. This substance is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. It is known for its potential pharmacological properties, including effects on the nervous system, which have been the subject of various studies. The compound's acetoxy group plays a significant role in its reactivity and interaction with biological targets. Additionally, 14-acetoxybupleurotoxin may exhibit specific stereochemistry, influencing its biological efficacy and mechanism of action. As with many alkaloids, it may possess both therapeutic potential and toxicity, necessitating careful handling and research to fully understand its effects and applications. The compound's CAS number, 111128-30-4, serves as a unique identifier in chemical databases, facilitating its study and the exploration of its properties in both academic and industrial contexts.
Formula:C19H24O3
InChI:InChI=1/C19H24O3/c1-3-15-19(22-18(2)21)16-13-11-9-7-5-4-6-8-10-12-14-17-20/h5,7,9,11-12,14,19-20H,3,13,15-17H2,1-2H3/b7-5+,11-9+,14-12-
Synonyms:- 14-Acetoxy-bupleurynol
- 14-Carbonyl-bupleurynol
- Acetylbupleurotoxin
- 2,8,10-Heptadecatriene-4,6-diyne-1,14-diol, 14-acetate, (Z,E,E)-
- (4E,6E,12Z)-14-hydroxy-1-propyltetradeca-4,6,12-triene-8,10-diyn-1-yl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
