CAS 111130-14-4
:1H-Tetrazole-5-carboxamide, N-(5-(3-(4-acetyl-3-hydroxy-2-propylphenox y)propoxy)-4-bromo-2-methylphenyl)-, monosodium salt
Description:
1H-Tetrazole-5-carboxamide, N-(5-(3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy)-4-bromo-2-methylphenyl)-, monosodium salt, identified by CAS number 111130-14-4, is a complex organic compound characterized by its tetrazole ring, which contributes to its potential biological activity. The presence of a carboxamide functional group enhances its solubility and reactivity, while the monosodium salt form indicates that it is likely soluble in water, making it suitable for various applications in pharmaceuticals or biochemistry. The compound features multiple aromatic rings and substituents, including a bromo group and an acetylated hydroxyphenyl moiety, which may influence its pharmacokinetic properties and interactions with biological targets. Its structural complexity suggests potential utility in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the presence of the sodium ion may play a role in stabilizing the compound in solution and facilitating its bioavailability. Overall, this compound exemplifies the intricate design often found in drug development.
Formula:C23H25BrN5NaO5
InChI:InChI=1/C23H26BrN5O5.Na/c1-4-6-16-19(8-7-15(14(3)30)21(16)31)33-9-5-10-34-20-12-18(13(2)11-17(20)24)25-23(32)22-26-28-29-27-22;/h7-8,11-12,25,31-32H,4-6,9-10H2,1-3H3;/q;+1/p-1
Synonyms:- CGP 33304
- sodium ({5-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-4-bromo-2-methylphenyl}amino)(5H-tetrazol-5-ylidene)methanolate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cgp 33304
CAS:CGP 33304 blocks leukotriene receptors and inhibits PLA2, averting hypoxia from leukotriene-induced bronchoconstriction.Formula:C23H26BrN5NaO5Color and Shape:SolidMolecular weight:555.385
