CAS 111140-93-3
:3-[3-(Trifluoromethyl)phenoxy]propanoic acid
Description:
3-[3-(Trifluoromethyl)phenoxy]propanoic acid, with the CAS number 111140-93-3, is an organic compound characterized by its distinctive trifluoromethyl group and phenoxy moiety. This compound features a propanoic acid backbone, which contributes to its acidic properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The phenoxy group can provide additional stability and reactivity, allowing for potential interactions with biological targets. Typically, compounds like this may exhibit herbicidal or fungicidal properties, making them valuable in agricultural applications. The molecular structure suggests that it may participate in hydrogen bonding due to the carboxylic acid functional group, which can affect its solubility and reactivity in different environments. Overall, 3-[3-(Trifluoromethyl)phenoxy]propanoic acid is a compound of interest due to its unique chemical features and potential applications in various scientific fields.
Formula:C10H9F3O3
InChI:InChI=1S/C10H9F3O3/c11-10(12,13)7-2-1-3-8(6-7)16-5-4-9(14)15/h1-3,6H,4-5H2,(H,14,15)
InChI key:InChIKey=PWGAEHHONPRIHO-UHFFFAOYSA-N
SMILES:O(CCC(O)=O)C1=CC(C(F)(F)F)=CC=C1
Synonyms:- 3-[3-(Trifluoromethyl)phenoxy]propanoic acid
- 3-[(3-Trifluoromethylphenyl)oxy]propanoic acid
- Propanoic acid, 3-[3-(trifluoromethyl)phenoxy]-
- 3-(3-Trifluoromethylphenoxy)propionic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
