CAS 111141-00-5: 8-Fluoro-4-chromanone
Description:8-Fluoro-4-chromanone is a chemical compound characterized by its chromanone structure, which consists of a benzene ring fused to a carbonyl-containing heterocyclic ring. The presence of a fluorine atom at the 8-position of the chromanone structure significantly influences its chemical properties, including its reactivity and potential biological activity. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure allows for various functional group transformations, making it a valuable intermediate in organic synthesis. 8-Fluoro-4-chromanone has garnered interest in medicinal chemistry due to its potential pharmacological applications, particularly in the development of novel therapeutic agents. Additionally, its unique electronic properties, stemming from the fluorine substitution, can enhance its interactions with biological targets. As with many fluorinated compounds, it may exhibit increased metabolic stability and altered lipophilicity, which can be advantageous in drug design. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C9H7FO2
InChI:InChI=1/C9H7FO2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-3H,4-5H2
- Synonyms:
- 8-Fluoro-4-Oxo-Chroman
- 8-Fluoro-2,3-dihydro-4H-chromen-4-one
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 8-Fluorochroman-4-one REF: IN-DA003NICCAS: 111141-00-5 | 95% | To inquire | Mon 03 Mar 25 |
![]() | 8-Fluorochroman-4-one REF: 54-PC200530CAS: 111141-00-5 | 0.99 | 129.00 €~867.00 € | Mon 10 Mar 25 |
![]() | 8-Fluoro-4-oxo-chroman REF: 10-F050206CAS: 111141-00-5 | 95.0% | To inquire | Thu 13 Mar 25 |
![]() | 8-Fluoro-4-chromanone REF: 3D-FF53994CAS: 111141-00-5 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
8-Fluorochroman-4-one
Ref: IN-DA003NIC
1g | 57.00 € | ||
5g | 173.00 € | ||
10g | 219.00 € | ||
25g | 499.00 € | ||
100g | To inquire | ||
100mg | 26.00 € | ||
250mg | 36.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
8-Fluoro-4-oxo-chroman
Ref: 10-F050206
1g | 36.00 € | ||
5g | 158.00 € | ||
250mg | 21.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
8-Fluoro-4-chromanone
Ref: 3D-FF53994
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
500mg | Discontinued | Request information |