CAS 111141-07-2

1,5,6,7-Tetrahydro-1,2-dimethyl-4H-indol-4-one

Description:

1,5,6,7-Tetrahydro-1,2-dimethyl-4H-indol-4-one, with the CAS number 111141-07-2, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the ring system, which contributes to its stability and reactivity. The presence of two methyl groups at the 1 and 2 positions of the indole structure influences its physical and chemical properties, such as solubility and boiling point. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. They may interact with various biological targets, potentially leading to therapeutic applications. Additionally, the compound's structural features suggest it may participate in various chemical reactions, including electrophilic substitutions and cyclizations, which are common in organic synthesis. Overall, 1,5,6,7-Tetrahydro-1,2-dimethyl-4H-indol-4-one represents a versatile scaffold for further chemical exploration and development.

Formula: C₁₀H₁₃NO

InChI: InChI=1S/C10H13NO/c1-7-6-8-9(11(7)2)4-3-5-10(8)12/h6H,3-5H2,1-2H3

InChI key: InChIKey=FIPFCYAIMHXQSX-UHFFFAOYSA-N

SMILES: CN1C2=C(C(=O)CCC2)C=C1C

Synonyms:

• 1,2-Dimethyl-4,5,6,7-tetrahydro-1H-indol-4-one
• 1,5,6,7-Tetrahydro-1,2-dimethyl-4H-indol-4-one
• 4H-Indol-4-one, 1,5,6,7-tetrahydro-1,2-dimethyl-