CAS 111158-92-0
:1-Ethenyl-4-[[2,2,2-trifluoro-1-(trifluoromethyl)ethoxy]methyl]benzene
Description:
1-Ethenyl-4-[[2,2,2-trifluoro-1-(trifluoromethyl)ethoxy]methyl]benzene, with the CAS number 111158-92-0, is an organic compound characterized by its complex structure that includes a vinyl group and a trifluoromethyl-substituted ether moiety. This compound features a benzene ring substituted at the para position with an ethenyl group, which contributes to its reactivity and potential applications in polymer chemistry and materials science. The presence of trifluoromethyl groups enhances its chemical stability and lipophilicity, making it useful in various industrial applications, including as a building block in the synthesis of fluorinated compounds. Additionally, the trifluoroethyl ether group may impart unique properties such as increased resistance to solvents and thermal degradation. The compound's unique characteristics, including its fluorinated structure, may also influence its interactions with biological systems, warranting further investigation into its environmental and health impacts. Overall, this compound exemplifies the versatility and significance of fluorinated organic compounds in modern chemistry.
Formula:C12H10F6O
InChI:InChI=1S/C12H10F6O/c1-2-8-3-5-9(6-4-8)7-19-10(11(13,14)15)12(16,17)18/h2-6,10H,1,7H2
InChI key:InChIKey=BCHKYDBUHXYDGK-UHFFFAOYSA-N
SMILES:C(OCC1=CC=C(C=C)C=C1)(C(F)(F)F)C(F)(F)F
Synonyms:- 1-Ethenyl-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)benzene
- 1-Ethenyl-4-{[2,2,2-Trifluoro-1-(Trifluoromethyl)Ethoxy]Methyl}Benzene
- 4-Vinylbenzyl 2H-Perfluoroprop-2Yl Ether
- Benzene, 1-ethenyl-4-[[2,2,2-trifluoro-1-(trifluoromethyl)ethoxy]methyl]-
- P-Vinylbenzyl Hexafluoro Isopropyl Ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(((1,1,1,3,3,3-Hexafluoropropan-2-yl)oxy)methyl)-4-vinylbenzene
CAS:Formula:C12H10F6OMolecular weight:284.19764-Vinylbenzyl hexafluoroisopropyl ether
CAS:4-Vinylbenzyl hexafluoroisopropyl ether
Molecular weight:284.20g/mol

