
CAS 1111637-86-5
:4-(3-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine
Description:
4-(3-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with both a pyrazole and a methylthio group. The presence of the iodine atom in the pyrazole moiety contributes to its potential reactivity and biological activity. This compound is typically classified as a heterocyclic organic compound, which may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The methylthio group can enhance lipophilicity, potentially affecting the compound's solubility and permeability. Additionally, the compound's synthesis and characterization may involve standard organic chemistry techniques, including nucleophilic substitutions and coupling reactions. Overall, 4-(3-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine represents a class of compounds that may have applications in drug development and other fields of chemical research.
Formula:C8H7IN4S
InChI:InChI=1S/C8H7IN4S/c1-14-8-10-3-2-6(12-8)5-4-11-13-7(5)9/h2-4H,1H3,(H,11,13)
InChI key:InChIKey=XBRURAHDFBJPMJ-UHFFFAOYSA-N
SMILES:IC=1C(=CNN1)C2=NC(SC)=NC=C2
Synonyms:- Pyrimidine, 4-(3-iodo-1H-pyrazol-4-yl)-2-(methylthio)-
- 3-Iodo-4-(2-(methylthio)pyrimidin-4-yl)-1H-pyrazole
- 4-(5-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine
- 4-(3-Iodo-1H-pyrazol-4-yl)-2-(methylthio)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.