CAS 1111637-92-3: N,3-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
Description:N,3-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a dimethyl group and a boron-containing moiety. The presence of the dioxaborolane group suggests that this compound may exhibit properties typical of organoboron compounds, such as reactivity in cross-coupling reactions and potential applications in organic synthesis and medicinal chemistry. The dimethyl substitution on the pyridine ring can influence the compound's electronic properties and steric hindrance, potentially affecting its reactivity and solubility. Additionally, the compound may exhibit specific interactions due to the nitrogen atom in the pyridine ring, which can participate in hydrogen bonding or coordination with metal ions. Overall, this compound's characteristics make it of interest in various fields, including pharmaceuticals and materials science, where boron-containing compounds are often utilized for their unique reactivity and functional properties.
Formula:C13H21BN2O2
InChI:InChI=1S/C13H21BN2O2/c1-9-7-10(8-16-11(9)15-6)14-17-12(2,3)13(4,5)18-14/h7-8H,1-6H3,(H,15,16)
InChI key:InChIKey=VZNAKHVRKWXDMU-UHFFFAOYSA-N
SMILES:N=1C=C(C=C(C1NC)C)B2OC(C)(C)C(O2)(C)C
- Synonyms:
- 2-Pyridinamine, N,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- N-Methyl-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine
- N,3-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine

2-Methylamino-3-methylpyridine-5-boronic acid pinacol ester, 96%
Ref: 02-H54534
1g | To inquire | ||
250mg | To inquire |

N,3-diMethyl-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-aMine
Ref: IN-DA003HOF
100mg | 213.00 € | ||
250mg | 338.00 € |

Ozenoxacin Impurity 10
Ref: 4Z-O-061011
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

METHYL-[3-METHYL-5-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDIN-2-YL]-AMINE
Ref: 10-F795198
1g | To inquire | ||
100mg | 205.00 € | ||
250mg | 312.00 € | ||
500mg | 488.00 € |

N,3-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine
Ref: 3D-LUB63792
1g | Discontinued | Request information | |
100mg | Discontinued | Request information |