CAS 1111638-06-2
:2-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyrimidine
Description:
2-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyrimidine is a chemical compound characterized by its complex structure, which includes an imidazopyrimidine core and a boron-containing dioxaborolane moiety. This compound typically exhibits properties such as moderate solubility in organic solvents, which can be attributed to its polar and non-polar functional groups. The presence of the boron atom suggests potential applications in medicinal chemistry, particularly in drug design and development, as boron-containing compounds often exhibit unique reactivity and biological activity. Additionally, the imidazo[1,2-a]pyrimidine framework is known for its role in various biological activities, including antimicrobial and anticancer properties. The compound's stability and reactivity can be influenced by the substituents on the imidazopyrimidine ring and the dioxaborolane group, making it a subject of interest for further research in synthetic and medicinal chemistry. Overall, this compound represents a fascinating intersection of boron chemistry and heterocyclic compounds, with potential implications in various fields.
Formula:C13H18BN3O2
InChI:InChI=1S/C13H18BN3O2/c1-9-7-17-8-10(6-15-11(17)16-9)14-18-12(2,3)13(4,5)19-14/h6-8H,1-5H3
InChI key:InChIKey=BVSOSXPBYPUVHZ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CN3C(N=C2)=NC(C)=C3
Synonyms:- 2-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyrimidine
- Imidazo[1,2-a]pyrimidine, 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2-Methyl-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Methylimidazo[1,2-a]pyrimidine-6-boronic acid pinacol ester
CAS:Formula:C13H18BN3O2Molecular weight:259.1119
