CymitQuimica logo

CAS 1111638-11-9

:

3-Chloro-5-methyl-5H-pyrrolo[2,3-b]pyrazine

Description:
3-Chloro-5-methyl-5H-pyrrolo[2,3-b]pyrazine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyrazine moiety. This compound features a chlorine atom and a methyl group attached to the pyrrolo structure, influencing its chemical reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom can enhance its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may possess biological activity, which could be of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, making it a subject of study in medicinal chemistry. As with many heterocycles, the compound's stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, 3-Chloro-5-methyl-5H-pyrrolo[2,3-b]pyrazine is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c1-11-3-2-5-7(11)10-6(8)4-9-5/h2-4H,1H3
InChI key:InChIKey=YDLMNLOKLZUARW-UHFFFAOYSA-N
SMILES:CN1C=2C(=NC=C(Cl)N2)C=C1
Synonyms:
  • 5H-Pyrrolo[2,3-b]pyrazine, 3-chloro-5-methyl-
  • 3-Chloro-5-methyl-5H-pyrrolo[2,3-b]pyrazine
Found 3 products.