
CAS 1111638-12-0
:B-(5-Methyl-5H-pyrrolo[2,3-b]pyrazin-3-yl)boronic acid
Description:
B-(5-Methyl-5H-pyrrolo[2,3-b]pyrazin-3-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrrolo-pyrazine moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the methyl group on the pyrrolo structure can influence its solubility and reactivity. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's unique structure may also impart specific biological activities, making it a subject of interest in drug discovery and development. Its stability, reactivity, and potential interactions with biological targets are essential characteristics that can be explored in further research.
Formula:C7H8BN3O2
InChI:InChI=1S/C7H8BN3O2/c1-11-3-2-5-7(11)10-6(4-9-5)8(12)13/h2-4,12-13H,1H3
InChI key:InChIKey=XZDQLOVFINCJHF-UHFFFAOYSA-N
SMILES:CN1C=2C(=NC=C(B(O)O)N2)C=C1
Synonyms:- [5-Methyl-5H-pyrrolo[2,3-b]pyrazin-3-yl]boronic acid
- Boronic acid, B-(5-methyl-5H-pyrrolo[2,3-b]pyrazin-3-yl)-
- B-(5-Methyl-5H-pyrrolo[2,3-b]pyrazin-3-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.