CAS 1111733-03-9

Borate(1-), trifluoro-1H-indol-5-yl-, potassium (1:1), (T-4)-

Description:

Borate(1-), trifluoro-1H-indol-5-yl-, potassium (1:1), commonly referred to by its CAS number 1111733-03-9, is a chemical compound that features a borate anion and a trifluoro-1H-indol-5-yl cation, balanced by potassium ions. This compound is characterized by its unique structural components, which include a boron atom bonded to oxygen atoms, forming the borate group, and an indole ring system that is substituted with trifluoromethyl groups. The presence of trifluoromethyl groups typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. As a potassium salt, it is likely to exhibit solubility in polar solvents, making it useful in various applications, including organic synthesis and potentially in medicinal chemistry. The trifluoro-1H-indol-5-yl moiety may impart specific properties that could be relevant in the development of pharmaceuticals or agrochemicals. Overall, this compound represents a fascinating intersection of boron chemistry and indole derivatives, with potential implications in various scientific fields.

Formula: C₈H₆BF₃N·K

InChI: InChI=1S/C8H6BF3N.K/c10-9(11,12)7-1-2-8-6(5-7)3-4-13-8;/h1-5,13H;/q-1;+1

InChI key: InChIKey=BLUZPWXLGGDSRM-UHFFFAOYSA-N

SMILES: [B+3]([F-])([F-])([F-])[C-]=1C=C2C(=CC1)NC=C2.[K+]

Synonyms:

• Borate(1-), trifluoro-1H-indol-5-yl-, potassium (1:1), (T-4)-