
CAS 111189-32-3
:Indeno[1,2,3-hi]chrysene
Description:
Indeno[1,2,3-hi]chrysene is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex fused ring structure, which consists of multiple aromatic rings. It is a solid at room temperature and is typically insoluble in water but soluble in organic solvents. This compound is of interest due to its potential environmental and health implications, as many PAHs are known to be carcinogenic. Indeno[1,2,3-hi]chrysene is often studied in the context of environmental pollution, particularly in relation to combustion processes and the degradation of organic materials. Its molecular structure contributes to its stability and persistence in the environment. Additionally, it may exhibit fluorescence properties, making it relevant in various analytical applications. Safety data indicate that exposure to this compound should be minimized, as it may pose risks to human health and the environment. Overall, Indeno[1,2,3-hi]chrysene serves as a significant subject of research in both environmental chemistry and toxicology.
Formula:C24H14
InChI:InChI=1S/C24H14/c1-2-7-16-15(6-1)12-13-19-21-11-5-10-20-17-8-3-4-9-18(17)23(24(20)21)14-22(16)19/h1-14H
InChI key:InChIKey=LFGDHICYJIULAO-UHFFFAOYSA-N
SMILES:C12=C3C=4C(C1=CC=CC2=C5C(=C3)C=6C(C=C5)=CC=CC6)=CC=CC4
Synonyms:- Naphtho[1,2-b]fluoranthene
- Indeno[1,2,3-hi]chrysene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.