CymitQuimica logo

CAS 111196-50-0

:

PENTAFLUORO(IODOMETHYL)-BENZENE

Description:
Pentafluoro(iodomethyl)benzene is an organofluorine compound characterized by the presence of five fluorine atoms and one iodomethyl group attached to a benzene ring. This compound typically exhibits a high degree of chemical stability due to the strong C-F bonds, which also contribute to its unique physical properties, such as low volatility and high density. The presence of the iodomethyl group introduces a polar functional group, which can enhance its reactivity in nucleophilic substitution reactions. Pentafluoro(iodomethyl)benzene is often utilized in various applications, including as a building block in organic synthesis and in the development of fluorinated materials. Its fluorinated nature may impart properties such as hydrophobicity and lipophobicity, making it useful in specialized coatings and materials. Additionally, the compound's structure allows for potential applications in medicinal chemistry and materials science, particularly in the design of fluorinated pharmaceuticals or agrochemicals. Safety considerations should be taken into account due to the potential toxicity associated with halogenated compounds.
Formula:C7H2F5I
InChI:InChI=1/C7H2F5I/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h1H2
SMILES:C(c1c(c(c(c(c1F)F)F)F)F)I
Synonyms:
  • 1,2,3,4,5-Pentafluoro-6-(Iodomethyl)Benzene
  • Pentafluoro(iodomethyl)-benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.