CymitQuimica logo

CAS 1112-33-0

:

(2R)-2,4-dihydroxy-3,3-dimethylbutanoic acid

Description:
(2R)-2,4-dihydroxy-3,3-dimethylbutanoic acid, also known as a derivative of a branched-chain amino acid, is characterized by its two hydroxyl groups and a carboxylic acid functional group, which contribute to its solubility in water and its ability to participate in various chemical reactions. This compound features a chiral center at the second carbon, leading to its specific stereochemistry, which can influence its biological activity and interactions. The presence of the dimethyl groups enhances its steric bulk, potentially affecting its reactivity and interactions with enzymes or receptors. As a dihydroxy acid, it can act as a chelating agent and may participate in metabolic pathways, particularly in the context of amino acid metabolism. Its CAS number, 1112-33-0, allows for precise identification in chemical databases. Overall, this compound's unique structure and functional groups make it of interest in both synthetic chemistry and biochemistry, particularly in studies related to metabolic processes and the synthesis of more complex molecules.
Formula:C6H12O4
InChI:InChI=1/C6H12O4/c1-6(2,3-7)4(8)5(9)10/h4,7-8H,3H2,1-2H3,(H,9,10)/t4-/m0/s1
SMILES:CC(C)(CO)[C@H](C(=O)O)O
Synonyms:
  • (R)-2,4-Dihydroxy-3,3-dimethylbutanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.