CAS 111205-02-8

6-(1H-Imidazol-1-yl)-3-pyridinemethanol

Description:

6-(1H-Imidazol-1-yl)-3-pyridinemethanol, with the CAS number 111205-02-8, is a chemical compound characterized by its unique structure that includes both an imidazole and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in polar solvents. The presence of the hydroxymethyl group contributes to its reactivity, allowing for various chemical modifications. It may act as a ligand in coordination chemistry or as an intermediate in organic synthesis. Additionally, compounds with similar structures are often investigated for their pharmacological properties, including antimicrobial or anti-inflammatory activities. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which the compound is studied. Overall, 6-(1H-Imidazol-1-yl)-3-pyridinemethanol represents a versatile scaffold in medicinal chemistry and organic synthesis.

Formula: C₉H₉N₃O

InChI: InChI=1S/C9H9N3O/c13-6-8-1-2-9(11-5-8)12-4-3-10-7-12/h1-5,7,13H,6H2

InChI key: InChIKey=NOXMQACPPMNESW-UHFFFAOYSA-N

SMILES: C(O)C1=CC=C(N=C1)N2C=CN=C2

Synonyms:

• 6-(1H-Imidazol-1-yl)-3-pyridinemethanol
• [6-(1H-Imidazol-1-yl)pyridin-3-yl]methanol
• (6-Imidazol-1-ylpyridin-3-yl)methanol
• 2-Imidazolyl-5-hydroxymethylpyridine
• 3-Pyridinemethanol, 6-(1H-imidazol-1-yl)-

[6-(1h-imidazol-1-yl)pyridin-3-yl]methanol

CAS: 111205-02-8

[6-(1h-imidazol-1-yl)pyridin-3-yl]methanol

Purity: 97%

Molecular weight: 175.19g/mol

Ref: 54-OR1036197

[6-(1h-imidazol-1-yl)pyridin-3-yl]methanol

CAS: 111205-02-8

Purity: 97%

Molecular weight: 175.1909943

Ref: 10-F676255

[6-(1H-Imidazol-1-yl)pyridin-3-yl]methanol

CAS: 111205-02-8

Versatile small molecule scaffold

Formula: C₉H₉N₃O

Purity: Min. 95%

Molecular weight: 175.19 g/mol

Ref: 3D-LEA20502