CAS 111205-30-2

Ethyl 4-chloro-5,6,7,8-tetrahydro-3-quinolinecarboxylate

Description:

Ethyl 4-chloro-5,6,7,8-tetrahydro-3-quinolinecarboxylate is a chemical compound characterized by its unique structure, which includes a quinoline ring system and an ethyl ester functional group. This compound features a chlorine atom at the 4-position of the quinoline ring, contributing to its reactivity and potential biological activity. The tetrahydro configuration indicates the presence of a saturated portion of the ring, which can influence its physical properties, such as solubility and melting point. Ethyl 4-chloro-5,6,7,8-tetrahydro-3-quinolinecarboxylate is often studied for its potential pharmacological applications, particularly in medicinal chemistry, due to the biological significance of quinoline derivatives. Its synthesis typically involves multi-step organic reactions, and it may exhibit various chemical behaviors, including nucleophilic substitution and electrophilic aromatic substitution, depending on the reaction conditions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₂H₁₄ClNO₂

InChI: InChI=1S/C12H14ClNO2/c1-2-16-12(15)9-7-14-10-6-4-3-5-8(10)11(9)13/h7H,2-6H2,1H3

InChI key: InChIKey=DKDMXYWZQVIKCI-UHFFFAOYSA-N

SMILES: ClC1=C2C(=NC=C1C(OCC)=O)CCCC2

Synonyms:

• 3-Quinolinecarboxylic acid, 4-chloro-5,6,7,8-tetrahydro-, ethyl ester
• Ethyl 4-chloro-5,6,7,8-tetrahydro-3-quinolinecarboxylate