CAS 111216-38-7: 3,3′,3′′-Nitrilotris[propanenitrile]
Description:3,3′,3′′-Nitrilotris[propanenitrile], with the CAS number 111216-38-7, is a chemical compound characterized by its structure, which includes three propanenitrile groups connected through a nitrile functional group. This compound is a nitrile derivative, indicating the presence of multiple cyano (-CN) groups, which contribute to its reactivity and potential applications in organic synthesis and materials science. The presence of multiple nitrile groups can enhance its ability to form coordination complexes with metals, making it of interest in coordination chemistry. Additionally, the compound may exhibit properties such as solubility in polar organic solvents and potential utility in the synthesis of polymers or other complex organic molecules. Its stability and reactivity can be influenced by factors such as temperature and the presence of other chemical species. As with many nitriles, it may also pose certain health and environmental risks, necessitating careful handling and consideration of safety protocols during its use in laboratory or industrial settings.
Formula:C9H12N4
InChI:InChI=1S/C9H12N4/c10-4-1-7-13(8-2-5-11)9-3-6-12/h1-3,7-9H2
InChI key:InChIKey=FYYPYNRGACGNNN-UHFFFAOYSA-N
SMILES:N#CCCN(CCC#N)CCC#N
- Synonyms:
- 3,3',3''-Nitrilotripropionitrile
- 3,3′,3′′-Nitrilotripropanenitrile
- 3,3′,3′′-Nitrilotripropionitrile
- 3,3′,3′′-Nitrilotris[propanenitrile]
- NSC 61541
- Propanenitrile, 3,3',3''-Nitrilotris-
- Propanenitrile, 3,3′,3′′-nitrilotris-
- Propionitrile, 3,3′,3′′-nitrilotri-
- Tris(2-cyanoethyl)amine
- Tris(beta-cyanoethyl)amine
- See more synonyms
- Tris(β-cyanoethyl)amine
- 3,3',3''-Nitrilotripropanenitrile
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Tris(2-cyanoethyl)amine REF: 3B-T1577CAS: | >99.0%(T) | 102.00 €~323.00 € | Mon 07 Apr 25 |

Tris(2-cyanoethyl)amine
Ref: 3B-T1577
5g | 102.00 € | ||
25g | 323.00 € |