CAS 1112178-33-2

Methyl 6-cyano-2-methyl-4-pyrimidinecarboxylate

Description:

Methyl 6-cyano-2-methyl-4-pyrimidinecarboxylate is a chemical compound characterized by its pyrimidine ring structure, which includes a cyano group and a methyl ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the cyano group, which can participate in nucleophilic reactions. The methyl ester group contributes to its overall polarity and can influence its reactivity in esterification or hydrolysis reactions. Additionally, the presence of the cyano group may impart unique electronic properties, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and agrochemicals. The compound's molecular structure suggests potential applications in the development of pharmaceuticals or as intermediates in organic synthesis. As with many pyrimidine derivatives, it may exhibit biological activity, warranting further investigation into its pharmacological properties. Safety data and handling precautions should be observed, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c1-5-10-6(4-9)3-7(11-5)8(12)13-2/h3H,1-2H3

InChI key: InChIKey=RRZQSHMWJHNJNQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(C#N)N=C(C)N1

Synonyms:

• Methyl 6-cyano-2-methyl-4-pyrimidinecarboxylate
• 4-Pyrimidinecarboxylic acid, 6-cyano-2-methyl-, methyl ester