CAS 111233-82-0
:2-Butanamine, phosphate (3:1)
Description:
2-Butanamine, phosphate (3:1) is an organic compound characterized by its amine functional group and phosphate moiety. It is a derivative of butanamine, which is a four-carbon primary amine, and is typically used in various chemical applications, including as a reagent in organic synthesis and in the formulation of pharmaceuticals. The phosphate component indicates that it forms a salt or complex with phosphoric acid, which can enhance its solubility and reactivity in biological systems. This compound may exhibit properties such as being hygroscopic and having moderate to high polarity, making it soluble in water and other polar solvents. Its structure allows for potential interactions with biological molecules, which may influence its behavior in biochemical pathways. Safety data should be consulted for handling and usage, as amines can be irritants and phosphates may have environmental implications. Overall, 2-Butanamine, phosphate (3:1) is a versatile compound with applications in both research and industry.
Formula:C4H11NH3O4P
InChI:InChI=1S/C4H11N.H3O4P/c1-3-4(2)5;1-5(2,3)4/h4H,3,5H2,1-2H3;(H3,1,2,3,4)
InChI key:InChIKey=WCNBWTAAGYSAED-UHFFFAOYSA-N
SMILES:C(CC)(C)N.P(=O)(O)(O)O
Synonyms:- 2-Butanamine, phosphate (3:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
