CAS 1112459-83-2

3-Methyl-6-[(methylamino)methyl]-2(3H)-benzoxazolone

Description:

3-Methyl-6-[(methylamino)methyl]-2(3H)-benzoxazolone, identified by its CAS number 1112459-83-2, is a chemical compound that belongs to the class of benzoxazolone derivatives. This substance typically exhibits a molecular structure characterized by a benzoxazolone core, which is a bicyclic compound featuring both a benzene ring and an oxazolone moiety. The presence of a methyl group and a methylamino side chain contributes to its unique chemical properties, potentially influencing its solubility, reactivity, and biological activity. Compounds of this type may exhibit various pharmacological effects, making them of interest in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and solubility, can vary based on the compound's purity and the conditions under which it is studied. Additionally, the compound's potential applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and interaction with other chemical entities. As with any chemical, safety data and handling precautions should be considered when working with this substance.

Formula: C₁₀H₁₂N₂O₂

InChI: InChI=1S/C10H12N2O2/c1-11-6-7-3-4-8-9(5-7)14-10(13)12(8)2/h3-5,11H,6H2,1-2H3

InChI key: InChIKey=VGLRPMOPZSCYJJ-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC(CNC)=CC2)OC1=O

Synonyms:

• 3-Methyl-6-[(methylamino)methyl]-2(3H)-benzoxazolone
• 2(3H)-Benzoxazolone, 3-methyl-6-[(methylamino)methyl]-