CAS 111248-90-9

2,1-Benzisothiazole, 4-chloro-1,3-dihydro-, 2,2-dioxide

Description:

2,1-Benzisothiazole, 4-chloro-1,3-dihydro-, 2,2-dioxide, with CAS number 111248-90-9, is a heterocyclic compound characterized by its fused benzene and isothiazole rings. This compound typically exhibits a pale yellow to light brown solid appearance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the chlorine atom and the sulfone functional group (dioxide) contributes to its reactivity and biological activity. It may possess antimicrobial or antifungal properties, making it of interest in medicinal chemistry. The compound is generally stable under standard conditions but may undergo reactions typical of halogenated compounds, such as nucleophilic substitution. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can exhibit toxicity. Overall, 2,1-benzisothiazole derivatives are valuable in synthetic organic chemistry and material science due to their unique structural features and functional properties.

Formula: C₇H₆ClNO₂S

InChI: InChI=1S/C7H6ClNO2S/c8-6-2-1-3-7-5(6)4-12(10,11)9-7/h1-3,9H,4H2

InChI key: InChIKey=LONQJZGBWSEYGO-UHFFFAOYSA-N

SMILES: ClC1=C2C(NS(=O)(=O)C2)=CC=C1

Synonyms:

• 2,1-Benzisothiazole, 4-chloro-1,3-dihydro-, 2,2-dioxide
• 1,3-Dihydro-2,2-dioxo-4-chloro-2,1-benzisothiazole

4-​Chloro-​1,​3-​dihydro-​2,​1-​benzisothiazole 2,​2-​dioxide

CAS: 111248-90-9

Versatile small molecule scaffold

Formula: C₇H₆ClNO₂S

Purity: Min. 95%

Molecular weight: 203.65 g/mol

Ref: 3D-LEA24890