
CAS 111252-32-5
:2-Propenoic acid, 3-(5-iodo-2-furanyl)-, (E)-
Description:
2-Propenoic acid, 3-(5-iodo-2-furanyl)-, (E)-, also known by its CAS number 111252-32-5, is an organic compound characterized by its structure, which features a propenoic acid moiety with a 5-iodo-2-furanyl substituent. This compound is part of the class of unsaturated carboxylic acids, which are known for their reactivity due to the presence of the double bond in the propenoic acid framework. The (E)- configuration indicates that the substituents on the double bond are on opposite sides, which can influence its chemical reactivity and physical properties. The presence of the iodine atom in the furanyl ring can enhance the compound's electrophilicity, making it potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the furan ring contributes to the compound's aromatic character, which may affect its stability and interactions with other molecules. Overall, this compound's unique structure may lend itself to applications in organic synthesis and materials science.
Formula:C7H5IO3
InChI:InChI=1S/C7H5IO3/c8-6-3-1-5(11-6)2-4-7(9)10/h1-4H,(H,9,10)/b4-2+
InChI key:InChIKey=QPFNTMHXPHLWHM-DUXPYHPUSA-N
SMILES:C(=C/C(O)=O)\C=1OC(I)=CC1
Synonyms:- 2-Propenoic acid, 3-(5-iodo-2-furanyl)-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.