CAS 111256-83-8

4-[4-(Dimethylamino)phenyl]-3H-1,2,4-triazole-3,5(4H)-dione

Description:

4-[4-(Dimethylamino)phenyl]-3H-1,2,4-triazole-3,5(4H)-dione, with the CAS number 111256-83-8, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a dimethylamino group attached to a phenyl ring, contributing to its potential as a biological or pharmaceutical agent. The presence of the triazole moiety often indicates possible applications in medicinal chemistry, particularly in the development of antifungal or antimicrobial agents. The compound is likely to exhibit moderate solubility in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, the dimethylamino group may impart basic properties, affecting its reactivity and interaction with other chemical species. Overall, this compound's unique structural features suggest it may have significant applications in various fields, including agrochemicals and pharmaceuticals, although specific biological activities would require further investigation.

Formula: C₁₀H₁₀N₄O₂

InChI: InChI=1S/C10H10N4O2/c1-13(2)7-3-5-8(6-4-7)14-9(15)11-12-10(14)16/h3-6H,1-2H3

InChI key: InChIKey=AVUQGOKVXPENDG-UHFFFAOYSA-N

SMILES: O=C1N(C2=CC=C(N(C)C)C=C2)C(=O)N=N1

Synonyms:

• 3H-1,2,4-Triazole-3,5(4H)-dione, 4-[4-(dimethylamino)phenyl]-
• 4-[4-(Dimethylamino)phenyl]-3H-1,2,4-triazole-3,5(4H)-dione

4-(4'-Dimethylaminophenyl)-1,2,4-Triazoline-3,5-Dione (DAPTAD)

CAS: 111256-83-8

Formula: C₁₀H₁₀N₄O₂

Molecular weight: 218.22

Ref: 4Z-D-124001