CAS 11126-42-4: Aroclor 5460
Description:Aroclor 5460 is a chlorinated biphenyl compound, part of a group of synthetic organic chemicals known as polychlorinated biphenyls (PCBs). It is characterized by its complex mixture of chlorinated biphenyls, which can vary in the number of chlorine atoms attached to the biphenyl structure. Aroclor 5460 typically contains a high degree of chlorination, resulting in a viscous, oily liquid that is generally colorless to light yellow. This compound is known for its chemical stability, hydrophobicity, and resistance to degradation, which contribute to its persistence in the environment. Aroclor 5460 has been used in various industrial applications, including as a dielectric fluid in capacitors and transformers, as well as in heat transfer fluids. However, due to its toxicological properties and potential environmental impact, including bioaccumulation and endocrine disruption, the use of Aroclor 5460 and other PCBs has been heavily regulated or banned in many countries. Safety precautions are essential when handling this substance, given its classification as a probable human carcinogen.
Formula:Unspecified
InChI:InChI=1/C18H5Cl9/c19-7-3-8(15(24)13(23)4-7)9-5-10(20)14(18(27)16(9)25)6-1-11(21)17(26)12(22)2-6/h1-5H
- Synonyms:
- Aroclor 5460
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Aroclor 5460 10 µg/mL in Cyclohexane REF: 04-L20246000CYCAS: 11126-42-4 | - - - | 78.00 € | Tue 04 Mar 25 |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Aroclor 5460 10 µg/mL in Cyclohexane
Controlled ProductRef: 04-L20246000CY
10ml | 78.00 € |