CAS 111283-90-0
:4-bromo-3-thiophenesulfonyl chloride
Description:
4-Bromo-3-thiophenesulfonyl chloride is an organic compound characterized by the presence of a bromine atom, a thiophene ring, and a sulfonyl chloride functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in various synthetic applications, including the preparation of sulfonamides and other derivatives. The bromine substituent can also serve as a site for further functionalization, enhancing its utility in organic synthesis. Additionally, this compound may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during use. Its solubility in organic solvents and stability under standard laboratory conditions make it a valuable intermediate in the synthesis of more complex molecules in pharmaceutical and materials chemistry. As with many sulfonyl chlorides, it is sensitive to moisture and should be stored in a dry environment to prevent hydrolysis.
Formula:C4H2BrClO2S2
InChI:InChI=1/C4H2BrClO2S2/c5-3-1-9-2-4(3)10(6,7)8/h1-2H
SMILES:c1c(c(cs1)S(=O)(=O)Cl)Br
Synonyms:- 4-Bromothiophene-3-Sulfonyl Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Bromothiophene-4-sulphonyl chloride
CAS:3-Bromothiophene-4-sulphonyl chlorideFormula:C4H2BrClO2S2Purity:95%Color and Shape: white to off-white crystalline crystalline powderMolecular weight:261.54447g/mol4-Bromo-3-thiophenesulfonyl Chloride, Technical grade
CAS:Controlled Product<p>Applications 4-Bromo-3-thiophenesulfonyl Chloride, Technical grade (cas# 111283-90-0) is a compound useful in organic synthesis.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C4H2BrClO2S2Color and Shape:NeatMolecular weight:261.54
