CymitQuimica logo

CAS 1112850-40-4

:

(5,6-Dimethoxypyridin-2-yl)methanamine

Description:
(5,6-Dimethoxypyridin-2-yl)methanamine is a chemical compound characterized by its pyridine ring structure, which is substituted at the 2-position with a methanamine group and at the 5 and 6 positions with methoxy groups. This compound typically exhibits properties associated with both amines and aromatic heterocycles, including potential basicity due to the presence of the amine functional group. The methoxy substituents can influence the compound's solubility, reactivity, and electronic properties, often enhancing its lipophilicity. As a pyridine derivative, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such compounds may exhibit biological activity. Additionally, the presence of methoxy groups can affect the compound's interaction with biological targets, potentially influencing its pharmacokinetic and pharmacodynamic profiles. Overall, (5,6-Dimethoxypyridin-2-yl)methanamine represents a versatile scaffold for further chemical exploration and development.
Formula:C8H12N2O2
InChI:InChI=1S/C8H12N2O2/c1-11-7-4-3-6(5-9)10-8(7)12-2/h3-4H,5,9H2,1-2H3
SMILES:COc1ccc(CN)nc1OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.