CAS 1112851-35-0

3-Cyclopropyl-4-methoxybenzenemethanamine

Description:

3-Cyclopropyl-4-methoxybenzenemethanamine is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a methoxy-substituted aromatic ring. The presence of the cyclopropyl group contributes to its potential as a building block in medicinal chemistry, as it can influence the compound's biological activity and pharmacokinetics. The methoxy group, being an electron-donating substituent, can enhance the compound's lipophilicity and affect its interaction with biological targets. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can be crucial for its reactivity and solubility in various solvents. Additionally, the specific arrangement of substituents can lead to interesting stereochemical considerations, impacting its overall behavior in chemical reactions and biological systems. While detailed studies on its specific applications and effects may be limited, compounds of this nature are often explored for their potential in drug development and other chemical applications.

Formula: C₁₁H₁₅NO

InChI: InChI=1S/C11H15NO/c1-13-11-5-2-8(7-12)6-10(11)9-3-4-9/h2,5-6,9H,3-4,7,12H2,1H3

InChI key: InChIKey=UWIKASUAPYGFDW-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(CN)C=C1)C2CC2

Synonyms:

• 1-(3-Cyclopropyl-4-methoxyphenyl)methanamine
• (3-Cyclopropyl-4-methoxyphenyl)methanamine
• 3-Cyclopropyl-4-methoxybenzenemethanamine
• Benzenemethanamine, 3-cyclopropyl-4-methoxy-