CAS 111293-23-3
:(-)-bis((S)-1-(ethoxycarbonyl)ethyl) fumarate
Description:
(-)-bis((S)-1-(ethoxycarbonyl)ethyl) fumarate, with the CAS number 111293-23-3, is a chiral compound that features a fumarate backbone, which is a derivative of fumaric acid. This substance is characterized by its two ethoxycarbonyl groups attached to the chiral carbon centers, contributing to its stereochemical properties. The presence of the ethoxycarbonyl groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. As a fumarate derivative, it may exhibit potential applications in pharmaceuticals, particularly in drug formulation or as a prodrug due to its ability to undergo hydrolysis. The compound's chirality suggests that it may have distinct biological activities depending on its stereoisomeric form. Additionally, its structural features may allow for specific interactions with enzymes or receptors, making it of interest in medicinal chemistry. Overall, (-)-bis((S)-1-(ethoxycarbonyl)ethyl) fumarate represents a unique chemical entity with potential implications in various fields, including organic synthesis and pharmacology.
Formula:C14H20O8
InChI:InChI=1/C14H20O8/c1-5-19-13(17)9(3)21-11(15)7-8-12(16)22-10(4)14(18)20-6-2/h7-10H,5-6H2,1-4H3/b8-7+/t9-,10-/m0/s1
Synonyms:- bis[(1S)-2-ethoxy-1-methyl-2-oxoethyl] (2E)-but-2-enedioate
- bis((S)-1-(ethoxycarbonyl)ethyl) fumarate
- ()-Bis[(S)-1-(ethoxycarbonyl)ethyl] fumarate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(-)-Bis(S)-1-(Ethoxycarbonyl)ethyl fumarate
CAS:<p>(-)-Bis(S)-1-(Ethoxycarbonyl)ethyl fumarate is a chemical compound that has been used for the synthesis of other compounds. This chemical has been shown to react with a wide range of nucleophiles and electrophiles, making it an important reagent in synthetic organic chemistry. (-)-Bis(S)-1-(Ethoxycarbonyl)ethyl fumarate is also useful as a scaffold for more complex molecules and as a building block for the synthesis of more complex structures.</p>Formula:C14H20O8Purity:Min. 95 Area-%Molecular weight:316.3 g/mol
