CymitQuimica logo

CAS 111302-55-7

:

3-(4-chlorophenyl)-1-(4-methoxyphenyl)propan-1-one

Description:
3-(4-Chlorophenyl)-1-(4-methoxyphenyl)propan-1-one, also known by its CAS number 111302-55-7, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with a 4-chlorophenyl group and a 4-methoxyphenyl group, which contribute to its unique chemical properties. The presence of the chlorophenyl group enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The methoxy group can also affect the compound's reactivity and stability, as it can participate in various chemical interactions. This compound is of interest in medicinal chemistry and may exhibit pharmacological properties, although specific biological activities would require further investigation. Its molecular structure suggests potential applications in the synthesis of other organic compounds or as an intermediate in pharmaceutical development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H15ClO2
InChI:InChI=1/C16H15ClO2/c1-19-15-9-5-13(6-10-15)16(18)11-4-12-2-7-14(17)8-3-12/h2-3,5-10H,4,11H2,1H3
SMILES:COc1ccc(cc1)C(=O)CCc1ccc(cc1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.