CymitQuimica logo

CAS 111302-96-6

:

CIS-2-AMINO-4-CYCLOHEXENE-1-CARBOXAMIDE

Description:
Cis-2-amino-4-cyclohexene-1-carboxamide is an organic compound characterized by its unique structural features, including a cyclohexene ring and an amino group. The presence of the cis configuration indicates that the substituents on the double bond are oriented on the same side, which can influence the compound's reactivity and physical properties. This compound is likely to exhibit polar characteristics due to the amino and carboxamide functional groups, which can engage in hydrogen bonding. As a result, it may have moderate solubility in polar solvents, such as water. The cyclohexene moiety contributes to its rigidity and potential for conformational isomerism. Additionally, the compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, given the presence of functional groups that can participate in further chemical reactions. Overall, the specific properties, such as melting point, boiling point, and reactivity, would require empirical data for precise characterization.
Formula:C7H13N2O
InChI:InChI=1/C7H12N2O/c8-6-4-2-1-3-5(6)7(9)10/h1-2,5-6H,3-4,8H2,(H2,9,10)/p+1/t5-,6+/m1/s1
InChI key:JXMUPIBGRUPBHN-RITPCOANSA-N
SMILES:C1C=CC[C@@H]([C@@H]1C(=O)N)N
Synonyms:
  • Cis-6-Amino-Cyclohex-3-Enecarboxylic Acid Amide
  • 3-Cyclohexene-1-carboxamide,6-amino-,cis-(9CI)
  • (1R,6S)-6-aminocyclohex-3-ene-1-carboxamide
  • (1S,6R)-6-carbamoylcyclohex-3-en-1-aminium
Found 2 products.