
CAS 111303-37-8
:3-Bromo-4-isoxazolemethanol
Description:
3-Bromo-4-isoxazolemethanol is a chemical compound characterized by its unique isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of a bromine atom at the 3-position of the isoxazole ring contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The hydroxymethyl group (-CH2OH) at the 4-position enhances its solubility in polar solvents and may influence its biological activity. This compound is often studied for its potential use in pharmaceuticals, particularly as a building block in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many brominated compounds, it may exhibit interesting electronic properties and reactivity patterns, making it a subject of interest in various chemical research fields. Safety data should be consulted for handling and storage, as brominated compounds can pose health risks.
Formula:C4H4BrNO2
InChI:InChI=1S/C4H4BrNO2/c5-4-3(1-7)2-8-6-4/h2,7H,1H2
InChI key:InChIKey=DWWKSWUMQHEBMZ-UHFFFAOYSA-N
SMILES:C(O)C=1C(Br)=NOC1
Synonyms:- (3-Bromo-1,2-oxazol-4-yl)methanol
- 4-Isoxazolemethanol, 3-bromo-
- 3-Bromo-4-isoxazolemethanol
- (3-Bromoisoxazol-4-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.