CAS 1113049-83-4

Benzoic acid, 2-amino-4-chloro-5-hydroxy-, methyl ester, hydrochloride (1:1)

Description:

Benzoic acid, 2-amino-4-chloro-5-hydroxy-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety modified with an amino group, a chloro substituent, and a hydroxy group, along with a methyl ester functional group. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. This compound is likely to exhibit properties typical of both benzoic acid derivatives and amines, such as potential antimicrobial activity and the ability to participate in various chemical reactions due to the presence of functional groups. Its molecular structure suggests it may engage in hydrogen bonding, influencing its physical properties like melting point and solubility. Additionally, the presence of chlorine may impart unique reactivity and stability characteristics. Overall, this compound's specific applications and behavior would depend on its interactions with biological systems and other chemical entities.

Formula: C₈H₈ClNO₃·ClH

InChI: InChI=1S/C8H8ClNO3.ClH/c1-13-8(12)4-2-7(11)5(9)3-6(4)10;/h2-3,11H,10H2,1H3;1H

InChI key: InChIKey=PPISZOFSVWMIMD-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(N)C=C(Cl)C(O)=C1.Cl

Synonyms:

• Benzoic acid, 2-amino-4-chloro-5-hydroxy-, methyl ester, hydrochloride (1:1)

2-Amino-4-chloro-5-hydroxybenzoic Acid Methyl Ester Hydrochloride

CAS: 1113049-83-4

Formula: C₈H₈ClNO₃HCl

Molecular weight: 201.61: 36.46

Ref: ST-EA-CP-A372004