CAS 1113050-16-0

Methyl 2,4-difluoro-5-iodobenzoate

Description:

Methyl 2,4-difluoro-5-iodobenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with two fluorine atoms and one iodine atom. The presence of these halogen substituents significantly influences its chemical properties, including reactivity and polarity. The methyl ester functional group contributes to its solubility in organic solvents and its potential use in various chemical reactions, such as nucleophilic substitutions. The compound is likely to exhibit moderate to high stability under standard conditions, but the presence of the iodine atom may make it susceptible to nucleophilic attack. Additionally, the difluoromethyl groups can enhance the compound's lipophilicity and alter its biological activity, making it of interest in medicinal chemistry and material science. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, Methyl 2,4-difluoro-5-iodobenzoate is a versatile compound with potential applications in synthesis and research.

Formula: C₈H₅F₂IO₂

InChI: InChI=1S/C8H5F2IO2/c1-13-8(12)4-2-7(11)6(10)3-5(4)9/h2-3H,1H3

InChI key: InChIKey=RKMKPEBEUQDDMM-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(F)C=C(F)C(I)=C1

Synonyms:

• Benzoic acid, 2,4-difluoro-5-iodo-, methyl ester
• Methyl 2,4-difluoro-5-iodobenzoate

Methyl 2,4-difluoro-5-iodobenzoate

CAS: 1113050-16-0

Methyl 2,4-difluoro-5-iodobenzoate

Formula: C₈H₅F₂IO₂

Purity: ≥95%

Color and Shape: white crystalline solid

Molecular weight: 298.02537g/mol

Ref: 54-PC53400