CAS 111317-90-9
:1-{[(4R,7S,10S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-13,16-di[(2S)-butan-2-yl]-10-{3-[(diaminomethylidene)amino]propyl}-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-N~5~-(diaminomethylidene)-L-ornithylglycin
Description:
The chemical substance with the name "1-{[(4R,7S,10S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-13,16-di[(2S)-butan-2-yl]-10-{3-[(diaminomethylidene)amino]propyl}-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-N~5~-(diaminomethylidene)-L-ornithylglycin" and CAS number "111317-90-9" is a complex organic compound characterized by its intricate structure, which includes multiple functional groups and stereocenters. This compound features a pentaazacycloicosane backbone, indicating a cyclic structure with five nitrogen atoms incorporated into the ring. The presence of amino groups suggests potential for biological activity, possibly as a peptide or a peptide-like molecule. The compound also contains various substituents, including butyl groups and carbonyl functionalities, which may influence its solubility and reactivity. Its structural complexity implies potential applications in medicinal chemistry, particularly in drug design or as a therapeutic agent. However, detailed studies would be necessary to elucidate its specific properties, biological interactions, and potential uses in various fields.
Formula:C41H73N17O10S2
InChI:InChI=1/C41H73N17O10S2/c1-5-20(3)30-37(66)53-24(11-8-14-50-41(47)48)34(63)54-25(16-28(43)59)35(64)55-26(19-70-69-18-22(42)32(61)56-31(21(4)6-2)38(67)57-30)39(68)58-15-9-12-27(58)36(65)52-23(10-7-13-49-40(45)46)33(62)51-17-29(44)60/h20-27,30-31H,5-19,42H2,1-4H3,(H2,43,59)(H2,44,60)(H,51,62)(H,52,65)(H,53,66)(H,54,63)(H,55,64)(H,56,61)(H,57,67)(H4,45,46,49)(H4,47,48,50)/t20-,21-,22-,23-,24-,25-,26-,27-,30?,31-/m0/s1
SMILES:CC[C@H](C)C1C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CSSC[C@@H](C(=N[C@@H]([C@@H](C)CC)C(=N1)O)O)N)C(=O)N1CCC[C@H]1C(=N[C@@H](CCCNC(=N)N)C(=NCC(=N)O)O)O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Conopressin S
CAS:Conopressin S, isolated from Conus striatus, shows high affinity with vasopressin V1b receptor (AVPR1B), with a Ki of 8.3 nM.Formula:C41H73N17O10S2Purity:98%Color and Shape:SolidMolecular weight:1028.26Conopressin S
CAS:Conopressin S is a synthetic peptide that activates the vasoconstrictor receptor. It is a potent activator of the vasoconstrictor receptor and is used as a research tool for its ability to inhibit ion channels. Conopressin S binds to the α-adrenergic receptor, which causes it to activate the G protein and increase cAMP levels. This increases blood pressure by causing smooth muscle relaxation in blood vessels.
Formula:C41H73N17O10S2Purity:Min. 95%Molecular weight:1,028.3 g/molRef: 3D-LEA31790
Discontinued product

