CAS 111337-84-9
:sperabillin C
Description:
Sperabillin C, with the CAS number 111337-84-9, is a naturally occurring compound classified as a secondary metabolite. It is primarily derived from certain fungal species and is known for its potential biological activities, including antimicrobial and antifungal properties. The compound features a complex molecular structure that contributes to its reactivity and interaction with biological systems. Sperabillin C has garnered interest in the field of medicinal chemistry due to its potential applications in drug development and as a lead compound for synthesizing new therapeutic agents. Its solubility, stability, and bioavailability are important characteristics that influence its efficacy in biological assays. Additionally, ongoing research aims to elucidate its mechanism of action and explore its potential in treating various diseases. As with many natural products, the extraction and purification processes are crucial for obtaining sperabillin C in sufficient quantities for further study. Overall, sperabillin C represents a promising area of research within the realm of natural product chemistry and pharmacology.
Formula:C15H27N5O3
InChI:InChI=1/C15H27N5O3/c1-2-3-4-5-14(22)20-10-12(21)8-11(16)9-15(23)19-7-6-13(17)18/h2-5,11-12,21H,6-10,16H2,1H3,(H3,17,18)(H,19,23)(H,20,22)/b3-2+,5-4+/t11-,12-/m1/s1
Synonyms:- (2E,4E)-N-[(2R,4R)-4-amino-6-{[(3Z)-3-amino-3-iminopropyl]amino}-2-hydroxy-6-oxohexyl]hexa-2,4-dienamide (non-preferred name)
- L-threo-Hexonamide, 3-amino-N-(3-amino-3-iminopropyl)-2,3,4,6-tetradeoxy-6-((1-oxo-2,4-hexadienyl)amino)-, (E,E)-
- Sperabillin C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Sperabillin C
CAS:Sperabillin C is a potent antibacterial antibiotic in vivo isolated from Pseudomonas fluorescens YK-437.Formula:C15H27N5O3Purity:98%Color and Shape:SolidMolecular weight:325.41
