CAS 111374-21-1
:6-(pyrrolidin-1-yl)-N-(2H-tetrazol-5-yl)pyrazine-2-carboxamide
Description:
6-(Pyrrolidin-1-yl)-N-(2H-tetrazol-5-yl)pyrazine-2-carboxamide is a chemical compound characterized by its complex structure, which includes a pyrazine ring, a carboxamide functional group, and a tetrazole moiety. The presence of the pyrrolidine ring contributes to its potential biological activity, as this cyclic amine can participate in various interactions with biological targets. The tetrazole group is known for its ability to mimic carboxylic acids and is often found in pharmaceuticals due to its stability and ability to form hydrogen bonds. This compound may exhibit properties such as solubility in polar solvents, and its specific interactions can be influenced by the functional groups present. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific receptors or enzymes. As with many compounds containing heterocycles, it may also display interesting pharmacological properties, making it a candidate for further research in drug discovery and development.
Formula:C10H12N8O
InChI:InChI=1/C10H12N8O/c19-9(13-10-14-16-17-15-10)7-5-11-6-8(12-7)18-3-1-2-4-18/h5-6H,1-4H2,(H2,13,14,15,16,17,19)
SMILES:C1CCN(C1)c1cncc(C(=Nc2n[nH]nn2)O)n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
HSR6071
CAS:HSR6071 is a histamine receptor antagonist that inhibits the release of histamine in tissues. HSR6071 is an effective inhibitor of cyclic AMP phosphodiesterase, which blocks the production of cyclic AMP and prevents the activation of cells. It has been shown to inhibit histamine-mediated bronchial hyperresponsiveness and mast cell degranulation in lung tissues with no significant side effects. HSR6071 has been shown to be effective in treating allergic reactions, such as asthma and eczema, by blocking histamine-mediated immunoglobulin E (IgE) production by sensitizing IgE-producing B cells and inhibiting their proliferation.Formula:C10H12N8OPurity:Min. 95%Molecular weight:260.26 g/molHSR6071
CAS:HSR6071 is a novel orally active and potent anti-allergic agent with inhibitory effects on passive cutaneous anaphylaxis.Formula:C10H12N8OPurity:99.59%Color and Shape:SolidMolecular weight:260.26


