CAS 111375-25-8

3-Amino-5-methoxy-1H-pyrazole-4-carboxamide

Description:

3-Amino-5-methoxy-1H-pyrazole-4-carboxamide is a chemical compound characterized by its pyrazole ring structure, which includes an amino group and a methoxy group as substituents. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The methoxy group can influence the compound's electronic properties and steric hindrance, potentially affecting its reactivity and interaction with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential applications in drug development, particularly in areas targeting specific enzymes or receptors. As with many pyrazole derivatives, it may also possess anti-inflammatory or analgesic properties, although specific biological activities would require empirical investigation. Overall, 3-Amino-5-methoxy-1H-pyrazole-4-carboxamide represents a versatile scaffold for further research in chemical and pharmaceutical sciences.

Formula: C₅H₈N₄O₂

InChI: InChI=1S/C5H8N4O2/c1-11-5-2(4(7)10)3(6)8-9-5/h1H3,(H2,7,10)(H3,6,8,9)

InChI key: InChIKey=IYCFIZNNSUHJFR-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C(OC)NN=C1N

Synonyms:

• 3-Amino-5-methoxy-1H-pyrazole-4-carboxamide
• 1H-Pyrazole-4-carboxamide, 3-amino-5-methoxy-

3-Amino-5-methoxy-1H-pyrazole-4-carboxamide

CAS: 111375-25-8

Formula: C₅H₈N₄O₂

Molecular weight: 156.1426

Ref: IN-DA0094PW

3-AMINO-5-METHOXY-1H-PYRAZOLE-4-CARBOXAMIDE

CAS: 111375-25-8

Formula: C₅H₈N₄O₂

Purity: 95.0%

Molecular weight: 156.145

Ref: 10-F467674

1h-pyrazole-4-carboxamide, 3-amino-5-methoxy-

CAS: 111375-25-8

Versatile small molecule scaffold

Formula: C₅H₈N₄O₂

Purity: Min. 95%

Molecular weight: 156.15 g/mol

Ref: 3D-LEA37525