CymitQuimica logo

CAS 111375-26-9

:

3-Amino-5-ethoxy-1H-pyrazole-4-carbonitrile

Description:
3-Amino-5-ethoxy-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of an amino group at the 3-position and an ethoxy group at the 5-position contributes to its reactivity and potential biological activity. The carbonitrile functional group at the 4-position enhances its polarity and can influence its solubility in various solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of agrochemicals or medicinal compounds, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. As with many nitrogen-containing heterocycles, it may also exhibit interesting biological activities, warranting further investigation in medicinal chemistry.
Formula:C6H8N4O
InChI:InChI=1S/C6H8N4O/c1-2-11-6-4(3-7)5(8)9-10-6/h2H2,1H3,(H3,8,9,10)
InChI key:InChIKey=IPMOHYSNRAVFGV-UHFFFAOYSA-N
SMILES:O(CC)C1=C(C#N)C(N)=NN1
Synonyms:
  • 3-Amino-5-ethoxy-1H-pyrazole-4-carbonitrile
  • 1H-Pyrazole-4-carbonitrile, 3-amino-5-ethoxy-
  • Pyrazole-4-carbonitrile, 3(or 5)-amino-5(or 3)-ethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.