
CAS 111375-27-0
:3-Amino-5-ethoxy-1H-pyrazole-4-carboxamide
Description:
3-Amino-5-ethoxy-1H-pyrazole-4-carboxamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2), contributing to its potential as a bioactive molecule. The ethoxy group (-OCH2CH3) enhances its solubility and may influence its pharmacological properties. The presence of these functional groups suggests that it may participate in hydrogen bonding, making it a candidate for various chemical reactions and interactions. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as pyrazole derivatives are known for their diverse biological activities, including anti-inflammatory and analgesic effects. Its molecular structure and properties can be further explored through techniques such as spectroscopy and chromatography, which can provide insights into its reactivity and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C6H10N4O2
InChI:InChI=1S/C6H10N4O2/c1-2-12-6-3(5(8)11)4(7)9-10-6/h2H2,1H3,(H2,8,11)(H3,7,9,10)
InChI key:InChIKey=KDIIJOANVVXKFI-UHFFFAOYSA-N
SMILES:O(CC)C1=C(C(N)=O)C(N)=NN1
Synonyms:- 3-Amino-5-ethoxy-1H-pyrazole-4-carboxamide
- 1H-Pyrazole-4-carboxamide, 3-amino-5-ethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.