CAS 111397-40-1
:6,6-difluorospermidine
Description:
6,6-Difluorospermidine is a chemical compound characterized by the presence of two fluorine atoms attached to the sixth carbon of the spermidine backbone, which is a polyamine involved in cellular processes. This compound is notable for its potential biological activity, particularly in relation to its role in cellular growth and function. The introduction of fluorine atoms can influence the compound's reactivity, stability, and interaction with biological systems, making it of interest in medicinal chemistry and biochemistry. 6,6-Difluorospermidine may exhibit altered properties compared to its non-fluorinated counterparts, such as changes in solubility, permeability, and binding affinity to biological targets. Its synthesis typically involves fluorination reactions, and it may be utilized in research to explore the effects of fluorinated polyamines in various biological contexts. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies are necessary to fully elucidate its pharmacological properties and potential applications in therapeutic settings.
Formula:C7H17F2N3
InChI:InChI=1/C7H17F2N3/c8-7(9,2-4-11)6-12-5-1-3-10/h12H,1-6,10-11H2
SMILES:C(CN)CNCC(CCN)(F)F
Synonyms:- 1,4-Butanediamine, N1-(3-aminopropyl)-2,2-difluoro-
- N~1~-(3-aminopropyl)-2,2-difluorobutane-1,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.