CAS 111397-41-2
:6,6-difluorospermine
Description:
6,6-Difluorospermine is a synthetic polyamine compound characterized by the presence of two fluorine atoms at the 6-position of the spermine backbone. This modification can influence its biological activity and interaction with cellular components. Polyamines, including spermine and its derivatives, are known to play crucial roles in cellular processes such as cell growth, differentiation, and apoptosis. The introduction of fluorine atoms may enhance the compound's stability and alter its binding affinity to various biological targets, potentially impacting its pharmacological properties. 6,6-Difluorospermine has been studied for its potential applications in cancer research and as a tool in molecular biology due to its ability to modulate cellular functions. Its unique structure may also provide insights into the design of new therapeutic agents. As with many chemical substances, safety and handling precautions are essential, given the potential biological effects and the need for further research to fully understand its mechanisms of action and therapeutic potential.
Formula:C10H24F2N4
InChI:InChI=1/C10H24F2N4/c11-10(12,9-16-7-2-5-14)3-8-15-6-1-4-13/h15-16H,1-9,13-14H2
SMILES:C(CN)CNCCC(CNCCCN)(F)F
Synonyms:- 1,4-Butanediamine, N,N'-bis(3-aminopropyl)-2,2-difluoro-
- N,N'-bis(3-aminopropyl)-2,2-difluorobutane-1,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.