CAS 1114-00-7
:rel-(2R,3R)-2,3-Dibromobutanedioic acid
Description:
Rel-(2R,3R)-2,3-Dibromobutanedioic acid, with the CAS number 1114-00-7, is a dibromo derivative of butanedioic acid, characterized by the presence of two bromine atoms attached to the second and third carbon atoms of the butanedioic acid backbone. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols due to the presence of carboxylic acid functional groups. The stereochemistry indicated by the (2R,3R) configuration suggests that the compound exhibits specific spatial arrangements, which can influence its reactivity and interactions with biological systems. It is often used in organic synthesis and as an intermediate in the production of various chemical compounds. The presence of bromine atoms can impart unique properties, such as increased reactivity in nucleophilic substitution reactions. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous.
Formula:C4H4Br2O4
InChI:InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/t1-,2-/s2
InChI key:InChIKey=FJWGRXKOBIVTFA-FNNSSLBKNA-N
SMILES:[C@H]([C@@H](C(O)=O)Br)(C(O)=O)Br
Synonyms:- Succinic acid, 2,3-dibromo-, (±)-
- Butanedioic acid, 2,3-dibromo-, (R*,R*)-(±)-
- rel-(2R,3R)-2,3-Dibromobutanedioic acid
- Butanedioic acid, 2,3-dibromo-, (R*,R*)-
- Butanedioic acid, 2,3-dibromo-, (2R,3R)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
