CAS 1114-07-4

(2R,3S)-2-Amino-3-methylsuccinic acid

Description:

(2R,3S)-2-Amino-3-methylsuccinic acid, with the CAS number 1114-07-4, is an amino acid derivative characterized by its chiral centers at the second and third carbon atoms. This compound features a carboxylic acid functional group, an amino group, and a methyl group, contributing to its classification as a non-proteinogenic amino acid. The presence of the two chiral centers gives rise to specific stereochemistry, which can influence its biological activity and interactions. It is soluble in water due to its polar functional groups, making it relevant in various biochemical applications. This compound can participate in peptide synthesis and may serve as a building block in the development of pharmaceuticals or as a research tool in studying metabolic pathways. Its structural characteristics allow it to engage in hydrogen bonding and other intermolecular interactions, which are crucial for its role in biological systems. Overall, (2R,3S)-2-amino-3-methylsuccinic acid is significant in both synthetic and natural chemistry contexts.

Formula: C₅H₉NO₄

InChI: InChI=1/C5H9NO4/c1-2(4(7)8)3(6)5(9)10/h2-3H,6H2,1H3,(H,7,8)(H,9,10)/t2-,3+/m0/s1

Synonyms:

• (3S)-rel-3-Methyl-D-aspartic acid
• (3S)-3-methyl-D-aspartic acid