
CAS 1114-59-6
:N,N-Dipropylpropanamide
Description:
N,N-Dipropylpropanamide, with the CAS number 1114-59-6, is an organic compound characterized by its amide functional group, which consists of a carbonyl (C=O) linked to a nitrogen atom (N) that is further bonded to two propyl groups. This structure imparts specific physical and chemical properties to the compound. Typically, N,N-Dipropylpropanamide is a colorless to pale yellow liquid with a relatively low boiling point, indicating it is likely to be volatile. It is soluble in organic solvents, reflecting its non-polar characteristics, while its amide group allows for potential hydrogen bonding interactions. The compound may exhibit moderate toxicity, and safety precautions should be taken when handling it. N,N-Dipropylpropanamide can be utilized in various applications, including as a solvent, in chemical synthesis, or as an intermediate in the production of other chemical compounds. Its unique properties make it of interest in both industrial and research settings.
Formula:C9H19NO
InChI:InChI=1S/C9H19NO/c1-4-7-10(8-5-2)9(11)6-3/h4-8H2,1-3H3
InChI key:InChIKey=ARCMPHHHUFVAOI-UHFFFAOYSA-N
SMILES:N(C(CC)=O)(CCC)CCC
Synonyms:- Propanamide, N,N-dipropyl-
- N,N-Dipropylpropionamide
- N,N-Di-n-propylpropionamide
- N,N-Dipropylpropanamide
- Propionamide, N,N-dipropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.